What is the meaning of Erucic_acid?
A long-chain unsaturated fatty acid, CH3(CH2)7CH=CH(CH2)11COOH, found in rapeseed and mustard seed oils; strictly, the cis-isomer of the molecule (the trans-isomer is called brassidic acid).
Source: wiktionary.org5 Letter Word Finder
5-letter words containing
5-letter words starting with
5-letter words in the middle
5-letter words ending with
5-letter words excluding
Search